9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one

Cost-effective customized wholesale 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one 2291-59-0 We provide high quality 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one (CAS 2291-59-0), at a very affordable prices to our customers.

1.What is the 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one ?

9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is a bicyclic chemical compound that features an azabicyclic ring containing nitrogen and a benzene ring. 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is recognized for its potential antimicrobial, antiviral, and anti-inflammatory properties, which render it a significant entity in pharmaceutical research and development. Additionally, it serves as a chiral auxiliary in asymmetric synthesis, contributing to its versatility and value in medicinal chemistry and drug development.

Used in Pharmaceutical Industry:
9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is used as a key intermediate in the synthesis of various pharmaceutical compounds due to its unique structural features and biological activities.
Used in Drug Development:
9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is utilized as a potential antimicrobial, antiviral, and anti-inflammatory agent for the development of new drugs targeting a range of infectious diseases and inflammatory conditions.
Used as a Chiral Auxiliary in Asymmetric Synthesis:
In the field of organic chemistry, 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is employed as a chiral auxiliary to facilitate the synthesis of enantiomerically pure compounds, which is crucial for the production of pharmaceuticals with specific biological activities and reduced side effects.

2.What is the CAS number for 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one ?

The CAS number of 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is 2291-59-0.

More information of 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one 2291-59-0 are:

3.What is the molecular formula of 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one ?

The chemical formula of?9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is C15H19NO which containing 15 Carbon atoms,19 Hydrogen atoms,1 Nitrogen atoms and 1 Oxygen atoms,and the molecular weight, and the molecular weight of 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is 229.32

4.What is 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one(2291-59-0)used for?

9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is a bicyclic chemical compound that features an azabicyclic ring containing nitrogen and a benzene ring. 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one is recognized for its potential antimicrobial, antiviral, and anti-inflammatory properties, which render it a significant entity in pharmaceutical research and development. Additionally, it serves as a chiral auxiliary in asymmetric synthesis, contributing to its versatility and value in medicinal chemistry and drug development.

InChI:InChI=1/C15H19NO/c17-15-9-13-7-4-8-14(10-15)16(13)11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2

Relevant articles related to 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one:

5.Cost-effective customized wholesale 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one 2291-59-0

Hebei Shengang Trading Co.,Ltd is a quality supplier of 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 9-Benzyl-9-azabicyclo[3.3.1]nonan-3-one 2291-59-0.